(a) In an experiment, a gas contracts from 0.674 L to 0.243 L under a constant external pressure of 2.138 bar. As this occurs, the gas also transfers 51.3 J of heat to its surroundings. If the gas is considered to be an ideal gas, what is AU (the change in internal energy) for the gas sample in joules (J)? (Note: See the second problem of the Basic Skills 1-2 Quiz to convert work to units of Joules.) (b) At the end of the compression in part (a), the gas is at thermal equilibrium. If the sample consists of 0.0506 moles, what is its temperature?

(a) In an experiment, a gas contracts from 0.674 L to 0.243 L under a constant external pressure of 2.138 bar. As this occurs, the gas also transfers 51.3 J of heat to its surroundings. If the gas is considered to be an ideal gas, what is AU (the change in internal energy) for the gas sample in joules (J)? (Note: See the second problem of the Basic Skills 1-2 Quiz to convert work to units of Joules.) (b) At the end of the compression in part (a), the gas is at thermal equilibrium. If the sample consists of 0.0506 moles, what is its temperature?

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 13P

See similar textbooks

Similar questions

Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
What is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
In which of the following systems is(are) work done by the surroundings on the system? Assume pressure and temperature are constant. a. 2SO2(g)+O2(g)2SO3(g) b.CO2(s)CO2(g) c. 4NH3(g)+7O2(g)4NO2(g)+6H2O(g) d.N2O4(g)2NO2(g) e.CaCO3(s)CaCO(s)+CO2(g)
Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6F
When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?
Define the terms system and surroundings. What does it mean to say that a system and its surroundings are in thermal equilibrium?