Given the following balanced equation and information: Fe₂O3 (s) + 3 CO (g) 2 Fe (s) + 3 CO₂ (g) . Reaction is run at 25.0 °C AGO is -29.5 kJ . The reaction is exothermic . . The sign of Ecell for the reaction is and the sign of ASuniverse is positive; negative positive; positive negative; positive negative; negative

Given the following balanced equation and information: Fe₂O3 (s) + 3 CO (g) 2 Fe (s) + 3 CO₂ (g) . Reaction is run at 25.0 °C AGO is -29.5 kJ . The reaction is exothermic . . The sign of Ecell for the reaction is and the sign of ASuniverse is positive; negative positive; positive negative; positive negative; negative

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter16: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 61E: Consider the reaction Fe2O3(s)+3H2(g)2Fe(s)+3H2O(g) a. Use Gf values in Appendix 4 to calculate G...

See similar textbooks

Similar questions

Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a Al2O3(s)+2Fe(s)Fe2O3(s)+2Al(s) b COCl2(g)+H2O(l)CO2(g)+2HCl(g)
The value of G for the reaction 2C4H10(g)+13O2(g)8CO2(g)+10H2O(l) is 5490. kJ. Use this value and data from Appendix 4 to calculate the standard free energy of formation for C4H 10(g).
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
For the reaction SF4(g)+F2(g)SF6(g) the value of G is 374 kJ. Use this value and data from Appendix 4 to calculate the value of Gf for SF4(g).
Using data from Appendix 4, calculate G for the reaction 2H2S(g)+SO2(g)3Srhombic(s)+2H2O(g) for the following conditions at 25C: PH2S=1.0104atmPSO2=1.0102atmPH2O=3.0102atm
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
Using values of fH and S, calculate rG for each of the following reactions at 25 C. (a) 2 Na(s) + 2 H2O() 2 NaOH(aq) + H2(g) (b) 6 C(graphite) + 3 H2(g) C6H6() Which of these reactions is (are) predicted to be product-favored at equilibrium? Are the reactions enthalpy- or entropy-driven?
Consider the reaction N2O(g)+NO2(g)3NO(g)K=4.41019 (a) Calculate G for the reaction at 25C. (b) Calculate G f for N2O at 25C.
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
Consider the reaction Fe2O3(s)+3H2(g)2Fe(s)+3H2O(g) a. Use Gf values in Appendix 4 to calculate G for this reaction. b. Is this reaction spontaneous under standard conditions at 298 K? c. The value of H for this reaction is 100. kJ. At what temperatures is this reaction spontaneous at standard conditions? Assume that H and S do not depend on temperature.