Answered: Write the relevant half-reactions, then…

Write the relevant half-reactions, then combine them into a full reaction, for FeS oxidation to Fe2+ and SO42- by O2 going to H2O

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 130AE

See similar textbooks

Related questions

Q: The mean radius of an orbital on the hydrogen atom is given by the expression: Calculate the mean…

A: Given:2p orbitalCalculate the mean radius of 2p orbital.The mean radius refers to the average…

Q: Suppose a 500. ml. flask is filled with 0.20 mol of Cl₂, 0.60 mol of CHCl3 and 2.0 mol of CC14. The…

A: The equilibrium constant relates the concentration of the reactant and product species present in…

Q: ake a look at this molecule, and then answer the questions in the table below it. CH₂OH H он H OH H…

Q: 7. Arrange the following ions in order of decreasing ionic radius: Al³+, Mg²+, Na, 0². decreasing…

A: All the species given in the above question are isoelectronic species.This indicates that all of…

Q: Complete the following nucleophilic addition reactions: Part A __ CH3–CH2–CH2CH + CH CHOH H+

A: In the above reaction an aldehyde and alcohol is treated in the presence of H+ (acid). This will…

Q: 2. You have prepared a sample of [Co(en)3]Br3 (en = H₂NCH₂CH₂NH₂). Which technique is best suited to…

A: Coordination compounds play a crucial role in inorganic chemistry, with the arrangement of ligands…

Q: A chemist prepares a solution of mercury(1) chloride (Hg, Cl.) by measuring out 0.00110 µmol of…

A: Note: 1 µmol = 10-3 mmolmoles of mercury(I) chloride = 0.00110 µmol = 0.00110 × 10-3 mmol = 1.10 ×…

Q: Provide reagents needed for the following transformations. More than one step is required for each…

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: HO C-CH₂-CH₂- ² ²1. 2 + 2 CH3CH₂OH Draw the molecule(s) on the canvas by choosing buttons from the…

A: The given reaction is a simple substitution reaction reaction at carbonyl carbon. This reaction has…

Q: A buffer is prepared using the weak acid lactic acid, HC3H5O3, and the salt NaC3H503 containing the…

A: A buffer solution consists of a mixture containing a weak acid and the conjugate base of the weak…

Q: Br HCI 2

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: You decided the make the following changes to the Recrystallization experiment. Otherwise, the…

A: Percentage yield is a measure of the efficiency of a chemical reaction in producing the desired…

Q: Complete and balance the reaction in acidic solution. 2 equation: ZnS + NO3 Zn²+ + S + NO Which…

A: The first step in this reaction is to identify which element is getting oxidized and which element…

Q: Which of the following triene, I, II, or Ill is the most stable? H H Н. Н C-CH₂ 11 111 0000 H2=C…

A: Alkene stability - Conjugated alkene is more stable tha unconjugated alkene.

Q: 1. Identify the planes: 11 D

A: The given images shows the planes inside the cubic lattice systems.lattice planes are imaginary…

Q: What is the chemical reaction equation for the dissolution of solid calcium hydroxide in water? A.…

Q: How many grams of FeCl3 and CuCl2 mixture should be taken to make 200mL with a solution…

A: Here we considered the mixture is in 1:1 ratio.

Q: What is the value of the equilibrium constant for the reaction between Sn (s) and Ag" (aq) at 25 °C?…

A: we have to calculate equilibrium constant for the reaction.

Q: Explain the following reaction mechanistically. Show ALL lone pairs, formal charges and CURLY…

Q: The molar solubility of PbCl₂ is 3.55 10³ M. Calculate the Ksp for PbCl₂

Q: Liquid acetone (C3H6O, 58.08 g/mol, “nail polish remover”) has a heat capacity of 2.14 J/(g K) and…

A: Given,mass of liquid acetone = 100.0 g molar mass = 58.08 g/mol specific heat capacity = 2.14 J/ (…

Q: fill in the blank draw products

A: In the given reaction we have to predict the product.The reactant is p-bromotoluene and it reacts…

Q: Determine the potential of a platinum electrode (vs. SHE) when placed in a mixture of 0.00385 M…

Q: Which of the following organic compound contains seven carbons? Octene ethane O propene O heptyne O…

A: We have to find which of the following organic compound contains seven carbons?Octene ethane propene…

Q: A 3 mole gas sample has a volume of 1 L, a pressure of 67.9 atm, and a temperature of 298 K. Is the…

A: To determine if the gas sample is behaving as an ideal or real gas, we can use the ideal gas…

Q: Y Part A The value of AG at 161.0°C for the formation of phosphorous trichloride from its…

A: Given,The reaction:P2 (g) + 3 Cl2 (g) 2 PCl3 (g) temperature = 161.0 oCAt 25.0 oC,

Q: When the Pb2+ concentration is 6.15x104 M, the observed cell potential at 298K for an…

A: Answer:-This question is answered by using the simple concept of Nernst equation which involves the…

Q: Draw the product of the reaction shown below. Ignore inorganic byproducts. O₂N. CH3CH₂NH2 Drawing…

A: Nucleophilic aromatic substitution is a classical reaction in which a nucleophile displaces a…

Q: Flipping the reactant and product in the reaction Zn → Zn²+ + 2 e will generate a non-spontaneous,…

A: Given:To determine:The oxidation-half reaction that needs to be coupled with the above reaction to…

Q: After your liquid-liquid extraction, you added concentrated acid solution to each of your basic…

A: The question addresses the role of concentrated acid in the recovery process of desired compounds…

Q: compound iron(II) bromide glycerol isopropanol formula FeBr₂ C₂Hg 03 CHO major species present when…

A: Strong electrolytes completely dissociate to produce constituent ions while weak electrolytes only…

Q: Select ALL structures that will be resonance forms of the following enolate: si EtO

A: Resonance is one of the electronic parameters that explains the stability of an organic compound.It…

Q: How much of a 5.4 M sucrose solution should you use to make 77.0 mL of a 0.045 M solution? Express…

A: To determine how much of a sucrose solution is needed to make of a solution, we can use the…

Q: 2. Given the pictures of four angular probability density plots (cross-sections) of four hydrogen…

A: Angular probability density plots of hydrogen atomic orbitals depict the probability density of…

Q: Which of the following is a nucleophile? O H₂C=CH2 O Brt OH3C-CH3 O (CH3)3*

A: We have to predict weak nucleophile .

Q: A. What is the electron-pair geometry for Xe in XeO3? There are lone pair(s) around the central…

Q: A sample of oxygen gas was collected via water displacement. Since the oxygen was collected via…

Q: If you had a voltaic cell and electolytic cell and ran an experiment to measure cell potenials what…

A: Voltaic Cell (Galvanic Cell):A voltaic cell is an electrochemical cell that converts chemical energy…

Q: Give the IUPAC name for the product of the following reaction. NO₂ LL 1. SnCl,. HO* 2. NaOH, H₂O

A: We have to find the product and write the IUAPC name of the product

Q: h) i) j) Cl₂ CH3OH H3PO4 A

A: H3PO4 is dehydrating agent and CH3OH act as nucleophile.

Q: draw the mass spectrum fragmentation structures of palmitic acid, fatty acid

A: Mass spectrometry is a destructive method of analysis. It is used to determine the molecular weight…

Q: 2. Rank these molecules in order of increasing pka. Explain your answer. CI CI б OH OH SOH CI OH OH

A: The question pertains to the ranking of five different molecules in order of increasing pKa values.…

Q: Indicate the mechanism by which the following reaction occurs. Question 6 options: SN1 SN2 E1 E2…

A: The given reaction involves the elimination of chlorine in the presence of formic acid and water to…

Q: A balloon that is filled with gas was released at ground level where the pressure was 751.0 mmHg and…

A: Given data from the questionAt initial state of balloon pressure (P1) = 751.0 mmHgTempreture (T1) =…

Q: 6. Draw the structure of the major organic product formed in the following reaction. A Ph Ġ B 1.…

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: 3. At T = 300K, 1bar of ¹60¹80 in a 1m³ box (lengths ax=ayaz = 1m) can be considered as an ideal…

A: Based on the type of motion the energies can be of three types:Translational energyRotational…

Q: > 8. Detailed calculations show that the value of Zeff for the outermost electrons in Si and Cl…

A: Effective nuclear charge () is the actual or the net amount of positive charge gained by an electron…

Q: Question 1. Give IUPAC names for alkyl halides given below. Draw all possible elimination product(s)…

A: Basic rules for IUPAC nomenclature:1) Select longest chain or block of carbon atoms as parent. 2)…

Q: What statement is TRUE about a Voltaic cell? (A voltaic cell is the same as a galvanic cell) O Cell…

A: A voltaic cell, also known as a galvanic cell, is an electrochemical cell that converts chemical…

Q: Problem 7 of 50 o Draw the products of the four step reaction sequence shown below. Ignore inorganic…

A: Benzene undergoes acylation when treated with acyl chloride in presence of Lewis acid.Wolf-Kishner…

Question

Write the relevant half-reactions, then combine them into a full reaction, for FeS oxidation to Fe2+ and SO42- by O₂ going to H₂O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Defining oxidation and reduction!

VIEW

Step 2: Oxidation half reaction!

VIEW

Step 3: Reduction half reaction!

VIEW

Step 4: Complete redox reaction!

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 5 steps with 12 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
A solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?