Fatty acid biosynthesis occurs through a series of reactions involving fatty acid synthase (FAS), a polypeptide multienzymecomplex. The result of this synthesis is a saturated fatty acid with up to 16 carbon atoms (palmitic acid). Longer fatty acids andunsaturated fatty acids result from modifications to fatty acids produced by FAS activity.What saturated fatty acid gives rise to myristoleic acid, CH3(CH2)3CH=CH(CH2),COOH?H₂H₂OHཔཱལིནཊྛདྡྷིསཏྟཔཱཎཱསིངྒཱརཨིནྡྷནཾ ཀིཾསུfatty acid + O2 + NADPH + H+H3CHHmyristoleic acid+ 2 H2O + NADP+Modufy the given molecule of myristoleic acid to show the fatty acid used to produce myristoleic acid.H₁C||НHOH

Step 1:Myristoleic acid [CH3(CH2)3CH=CH(CH2)7COOH] has 14 carbon atoms. To determine the saturated…

Answered: Fatty acid biosynthesis occurs through…

Human Heredity: Principles and Issues (MindTap Course List)

11th Edition

ISBN:9781305251052

Author:Michael Cummings

Publisher:Michael Cummings

Chapter10: From Proteins To Phenotypes

Section: Chapter Questions

Problem 14QP: If phenylalanine was not an essential amino acid, would diet therapy (the elimination of...

See similar textbooks

Similar questions

Explain why people with a hereditary deficiency of carnitine acyltransferase II have muscle weakness. Why are the symptoms more severe during fasting?
The second step during elongation of fatty acid chain is catalyzed by B-ketoacyl reducatse. In which 2 ways is this reaction different from the corresponding reaction in fatty acid degradation?
Explain why people with a hereditary deficiency of carnitine acyltransferase II have muscle weakness. Why are the symptoms more severe during fasting? (Keep your answer to at least a paragraph)
During fatty acid biosynthesis, is it correct that the product detaches from fatty acid synthase complex when the chain length is 16 carbons?
Homocystinuria is caused by a defect in cystathionine beta-synthase (or 13-synthase), which leads to an accumulation of homocysteine in the blood. This accumulation causes symptoms such as a tall, thin frame, flushed cheeks, and osteoporosis (thinning of the bones). These individuals should limit their intake of proteins that contain methionine, such as egg whites. Using your understanding of biochemistry, explain why people with Homocystinuria should not consume egg whites and other such proteins.
Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATP
Consider the each of the amino acids in the peptide below. Ala-Ile-Asp-Arg-Gln-Gly-Pro-Gly-Ala-Tyr-Val-Ile-Gln-Leu If all of the amino acids are degraded to yield energy (ATP), explain how many Acetyl CoAs for oxidation to CO2 could be produced from this peptide. note: Do not make glucose at the beginning, however converting the TCA intermediates into molecules in the glycolytic pathway for optimal Acetyl CoA production is allowed. Be sure to show clearly which pathway will the Acetyl CoA enter (to yield ATP ultimately) under such condition
1) under intracellular conditions, answer : If G3P-DH is inhibited by Iodoacetic acid, which glycolytic intermediate will accumulate most rapidly and why ? 2) How will increased oxaloacetate level in mitochondria affect fatty acid biosynthesis ?
Explain why the CIS form is the predominant confiiguration of unsaturated fatty acids?
Is the statement during fatty acid biosynthesis, the product detaches from fatty acid synthase complex when the chain length is 16 carbons, wrong or right?
From what fatty acid are most of the eicosanoids derived?List several medical conditions in which the suppression ofeicosanoid synthesis may appear to be advantageous.
Which fatty acid(s) out of the following four: palmitoleate, oleate, linoleate, and linolenate, can be a biosynthetic precursor in mammals for the polyunsaturated fatty acid 20:4 all-cis-D5 ,D8 ,D11 ,D14 ? Briefly sketch the steps of the possible synthesis from the chosen precursor using symbols only for the fatty acids. (Hint: mammalian systems contain four terminal desaturases of broad chainlength specificities designated as D9 -, D6 -, D5 -, and D4 -fatty acyl desaturases.) Please give a detailed answer, and explain the process, what is used, and why..

SEE MORE QUESTIONS

Recommended textbooks for you

Human Heredity: Principles and Issues (MindTap Co…

Biology

ISBN:

9781305251052

Author:

Michael Cummings

Publisher:

Cengage Learning