Pure magnesium metal is often found as ribbons and can easily burn in the presence of oxygen. When 3.51 g of magnesium ribbon burns with 8.71 g of oxygen, a bright, white light and a white, powdery product are formed. Enter the balanced chemical equation for this reaction. Be sure to include all physical states. equation: What is the limiting reactant? magnesium oxygen If the percent yield for the reaction is 82.3%, how many grams of product were formed? mass of product formed: How many grams of the excess reactant remain? mass of excess reactant: 50 g g

Q: Distinguish the difference of primary, secondary and tertiary alcohol. Typewritten and in essay…

A: Organic compounds are made up of carbon and hydrogen. These organic compounds are called…

Q: g e. CH3CH2CH(OCH3)CH2CH2CH2OH f. केभ

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: 5. A compound has a formula C3H₂N. Propose a structure for this compound using the H-1 and C-13 NMR…

A: Given, the formula of the compound: C3H9N We have to find the structure of the compound from the H-1…

Q: The salt cobalt(II) sulfate dissolves in water according to the reaction: CoSO4(s)-Co2+ (aq) +…

A: Answer: A compound CoSO4 is being dissolved in water and we have to identify whether this…

Q: 18. Predict this element based on the image:

A: For a given element : Atomic number = number of electron = number of proton Atomic mass = number of…

Q: Net ionic equation of NaCl + AgNO3 —> NaNO3 + AgCl

A:

Q: Longer wavelength photons have larger amounts of energy. a standard amount of energy. almost no…

A:

Q: 31 Balanced chemical equation: Mg + HCI -> Balanced ionic equation: wor Balanced net ionic equation:…

A:

Q: Distinguish the difference and its properties of primary, secondary and tertiary alcohol

A: Organic compound which contains alcohol group ( -OH) is called alcohol.  Alcohols are classified as…

Q: Calculate the percent yield if 1.18 g of copper is produced from 5.48 g of copper(II) sulfate and…

A:

Q: phosphate buffer at pH 7.5. You are out of solid versions of phosphate, but you find stock solutions…

A: Solution: Postpartic acid is tribasic basic acid (contains three protons), therefore it have three…

Q: How do shape and symmetry influence the polarity of a molecule?  cite specific examples.     2.…

A: 1) Shape and symmetry has a great role in determining the polarity of a molecule. A complete…

Q: How many moles of sucrose (342 g/mol) must be added to 552 g of water (18.02 g/mol) to give a…

A: Given - Weight of water =552 gram Molar mass of sucrose =342 g/mol  Molar mass of water =18.02g/mol…

Q: 4.) Provide mechanisms for the following reactions: + Br- CH3 CH3 CH3 CH3 AlCl3 CH3 of CH3 CH3 CH3

A:

Q: Gaseous nitrogen and hydrogen undergo a reaction to form gaseous ammonia. From this reaction 0.907…

A: Given : mass of N2 = 2.71 grams            NH3 produced = 0.907 grams  Tip : percent yield = actual…

Q: volume of 1.04 M sulfuric acid that would be needed to neutralize 53.1 mL of a 3.06 M aqueous…

A:

Q: Calculate the energy in kJ/mol corresponding to 4β.

A: Beta is known as resonance or stabilization integral having value -75KJ/mol .

Q: Which statement best defines specific heat? The amount of heat required to increase the temperature…

A:

Q: 19) Dinitrogen tetroxide partially decomposes according to the following equilibrium: N204 (g) 2NO2…

A: Given : equilibrium reaction

Q: QUESTION 4 The molecule оооо 1,3,5,7-cyclooctatetraene shown below is which of the following…

A:

Q: Calcium carbonate is used in many antacids to neutralize stomach acid, as depicted by the following…

A: Chemical equation for given reaction is as follows: CaCO3 (s) + 2 HCl(aq) → CaCl2 + H2O(l) + CO2(g)…

Q: QUESTION 1: A CH3 B 1) NaOH, 25 °C 2) C CH3 1) NaOEt alara OEt 2) Br H₂C Eto 1) LDA, -78 °C 2) Br

A:

Q: 12 Consider the electrically neutral isotopes 45Sc, 46T₁, and 47v. Select all the true statements.…

A: Isotopes :  These are electrically neutral atom which have same number of proton but different…

Q: 11) Which of the following is a STRONG acid? A) NH4+ B) C6H5CO2H C) HC104 D) H₂O E) HCN

A: 11) Strong acid : A strong acid is an acid which is completely ionized in an aqueous solution.…

Q: 14. For the theoretical reaction X+Y+Z→ products, the rate law is determined to be rate =…

A: Given that, Theoretical Reaction X + Y + Z --------> products Rate law for thi reaction is given…

Q: approximate var ਜਾ H-C-C=N: H Express the bonding angles in degrees to four significant digits…

A:

Q: The following is an alpha plot for a monoprotic weak acid, HA. 1.0 a 0.5 PH 8 (1) At low pH the…

A: Alpha is the ratio of the concentration of the species to the solution's formal concentration that…

Q: g. Br -CH3 i. H₂C Br I CH CH Cl CH₂CH3

A: Since you have posted a  question with sub-parts , we are entitled to answer the first three…

Q: Calculate the temporary hardness, permanent and total hardness of the sample of water from the…

A: Temporary hardness is due to the presence of calcium hydrogencarbonate Ca(HCO3)2(aq) and magnesium…

Q: Sodium carbonate (Na2CO3) is used to neutralize the sulfuric acid spill. How many kilograms of…

A: Balanced reactions: Na2CO3 + H2SO4 ----> Na2SO4 + H2O + CO2 Given- Mass of H2SO4 = 5.04 x 103 kg…

Q: 3. How would you prepare 500.0 mL of a 0.750 M solution using Sulfuric acid from 18.0 M concentrated…

A: a) Given: M1 = 18 M, M2 = 0.75 M, V2 = 500 mL, V1= ? Use dilution formula M1×V1=M2×V2 V1=M2×V2M1…

Q: 6. Give the IUPAC name of the molecule: ОН

A:

Q: When 25.0 mL of 0.650 M NaOH is titrated with HCl, 37.19 mL are required to reach the endpoint. What…

A:

Q: Calculate the entropy of mixing if two moles of nitrogen gas are mixed with one mole of oxygen gas…

A:

Q: Chemistry Question

A: Diels-Alder reaction : It is a [4+2] cycloaddition reaction between a diene and dienophile to form a…

Q: mechanism that explains the formation of the following product. In your mechanism, explain the cause…

A: In this question, we have to explain the steps in the given mechanism.

Q: Gaseous butane CH3CH22CH3 will react with gaseous oxygen O2 to produce gaseous carbon dioxide CO2…

A: Given that Gaseous butane, CH3CH2CH2CH3 (C4H10) will react with gaseous oxygen, O2 to produce…

Q: Write a structural formula for the principal organic product formed in the reaction of methyl…

A:

Q: Ammonia reacts with oxygen according to the equation 4 NH3(g) + 5O₂(g) → 4 NO(g) + 6 H₂O(g). If the…

A: The rate of the formation of the product or the rate of disappearance of the reactants is known as…

Q: What is the energy difference between the F2 molecule and the separated atoms? Express your answer…

A: Introduction: To calculate the energy difference between F2(g) molecule and its seperated atoms we…

Q: When heated, KCIO3 decomposes into KCl and O₂. 2 KClO3 → 2 KCl + 302 If this reaction produced 34.9…

A:

Q: The experimental data from a certain reaction gives these three graphs. What is the order for this…

A: To determine the order of reaction, we would check for which rate equation, a straight line graph is…

Q: 2. Answer the following. Show all of your work. A. For a 0.1 M solution of Agt, what concentration…

A: [Ag+] =0.1 M Ksp of AgCl = Ksp = 1.8 x 10-10

Q: Select the monomer that would make the following polymer: ty O

A: A polymer is a large molecule that is formed by the repetition of small units called a monomer, and…

Q: CH CH CH CH.CI

A:

Q: The image below shows a portion of a 'H NMR spectrum (ppm). Choose the partial structure that best…

A:

Q: 1. A 100 mL volume of 0.10 M H₂A, a diprotic acid, is titrated with 1.0 M KOH. The diprotic acid has…

A:

Q: Gaseous ethane CH3CH3 will react with gaseous oxygen O2 to produce gaseous carbon dioxide CO2 and…

A:

Q: A student ran the following reaction in the laboratory at 700 K: N2(g) + 3H2(g) → 2NH3 (9) When she…

A:

Q: I.Identifying if lonic or Covalent bond and show how they form their bonds. 1.Show how Mg and Cl…

A: Ionic bonds are formed by complete transfer of electrons and covalent bonds are formed by mutual…

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".